C15H21F3N2O3 — CID 136572531
2-butoxy-N-[4-(2-hydroxyethylamino)-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 136572531) has the molecular formula C15H21F3N2O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-butoxy-N-[4-(2-hydroxyethylamino)-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-butoxy-N-[4-(2-hydroxyethylamino)-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 136572531 |
| Molecular Formula | C15H21F3N2O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-butoxy-N-[4-(2-hydroxyethylamino)-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCCCOCC(=O)Nc1ccc(NCCO)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H21F3N2O3/c1-2-3-8-23-10-14(22)20-11-4-5-13(19-6-7-21)12(9-11)15(16,17)18/h4-5,9,19,21H,2-3,6-8,10H2,1H3,(H,20,22) |
| InChIKey | ZURBAUMOQRFXNO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|