C12H16F3N3O2S — CID 136574946
N-ethyl-5-pyrrolidin-1-ylsulfonyl-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 136574946) has the molecular formula C12H16F3N3O2S and a molecular weight of 323.34 g/mol. Its IUPAC name is N-ethyl-5-pyrrolidin-1-ylsulfonyl-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-ethyl-5-pyrrolidin-1-ylsulfonyl-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 136574946 |
| Molecular Formula | C12H16F3N3O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-ethyl-5-pyrrolidin-1-ylsulfonyl-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCNc1ncc(S(=O)(=O)N2CCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O2S/c1-2-16-11-10(12(13,14)15)7-9(8-17-11)21(19,20)18-5-3-4-6-18/h7-8H,2-6H2,1H3,(H,16,17) |
| InChIKey | MWGJPCYUVUKEDW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |