C18H18N2O5S — CID 136595770
methyl (3S)-3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-(4-hydroxyphenyl)butanoate (PubChem CID 136595770) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is methyl (3S)-3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-(4-hydroxyphenyl)butanoate.
| Compound Name | methyl (3S)-3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-(4-hydroxyphenyl)butanoate |
|---|---|
| PubChem CID | 136595770 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | methyl (3S)-3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-(4-hydroxyphenyl)butanoate |
| SMILES | COC(=O)C[C@H](Cc1ccc(O)cc1)/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H18N2O5S/c1-25-17(22)11-13(10-12-6-8-14(21)9-7-12)19-18-15-4-2-3-5-16(15)26(23,24)20-18/h2-9,13,21H,10-11H2,1H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | BTJOHCYUASNXEX-ZDUSSCGKSA-N |
| XLogP | 1.61 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|