C26H23N5O4 — CID 136646863
(5R)-5-[2-[3-(ethyliminomethyl)-1H-indol-6-yl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 136646863) has the molecular formula C26H23N5O4 and a molecular weight of 469.50 g/mol. Its IUPAC name is (5R)-5-[2-[3-(ethyliminomethyl)-1H-indol-6-yl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-[3-(ethyliminomethyl)-1H-indol-6-yl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 136646863 |
| Molecular Formula | C26H23N5O4 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (5R)-5-[2-[3-(ethyliminomethyl)-1H-indol-6-yl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC/N=C/c1c[nH]c2cc(C#C[C@]3(CN4Cc5ccc(OC)cc5C4=O)NC(=O)NC3=O)ccc12 |
| InChI | InChI=1S/C26H23N5O4/c1-3-27-12-18-13-28-22-10-16(4-7-20(18)22)8-9-26(24(33)29-25(34)30-26)15-31-14-17-5-6-19(35-2)11-21(17)23(31)32/h4-7,10-13,28H,3,14-15H2,1-2H3,(H2,29,30,33,34)/b27-12+/t26-/m1/s1 |
| InChIKey | LZDCXPKOTUHDGG-NYNBUFQQSA-N |
| XLogP | 2.20 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|