C25H23N7O7 — CID 136660389
N-[3-[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enyl]-2,3-dihydroxy-5-(pyridine-4-carbonyl)benzamide (PubChem CID 136660389) has the molecular formula C25H23N7O7 and a molecular weight of 533.50 g/mol. Its IUPAC name is N-[3-[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enyl]-2,3-dihydroxy-5-(pyridine-4-carbonyl)benzamide.
| Compound Name | N-[3-[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enyl]-2,3-dihydroxy-5-(pyridine-4-carbonyl)benzamide |
|---|---|
| PubChem CID | 136660389 |
| Molecular Formula | C25H23N7O7 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | N-[3-[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enyl]-2,3-dihydroxy-5-(pyridine-4-carbonyl)benzamide |
| SMILES | Nc1ncnc2c1ncn2C1OC(C=CCNC(=O)c2cc(C(=O)c3ccncc3)cc(O)c2O)C(O)C1O |
| InChI | InChI=1S/C25H23N7O7/c26-22-17-23(30-10-29-22)32(11-31-17)25-21(37)20(36)16(39-25)2-1-5-28-24(38)14-8-13(9-15(33)19(14)35)18(34)12-3-6-27-7-4-12/h1-4,6-11,16,20-21,25,33,35-37H,5H2,(H,28,38)(H2,26,29,30) |
| InChIKey | CEHVTXNJJNDZOC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 218.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|