C24H27N7O7 — CID 69223344
5-(4-amino-3-methyl-4-oxobut-2-en-2-yl)-N-[3-[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enyl]-2,3-dihydroxybenzamide (PubChem CID 69223344) has the molecular formula C24H27N7O7 and a molecular weight of 525.52 g/mol. Its IUPAC name is 5-(4-amino-3-methyl-4-oxobut-2-en-2-yl)-N-[3-[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enyl]-2,3-dihydroxybenzamide.
| Compound Name | 5-(4-amino-3-methyl-4-oxobut-2-en-2-yl)-N-[3-[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 69223344 |
| Molecular Formula | C24H27N7O7 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 5-(4-amino-3-methyl-4-oxobut-2-en-2-yl)-N-[3-[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enyl]-2,3-dihydroxybenzamide |
| SMILES | CC(C(N)=O)=C(C)c1cc(O)c(O)c(C(=O)NCC=CC2OC(n3cnc4c(N)ncnc43)C(O)C2O)c1 |
| InChI | InChI=1S/C24H27N7O7/c1-10(11(2)21(26)36)12-6-13(17(33)14(32)7-12)23(37)27-5-3-4-15-18(34)19(35)24(38-15)31-9-30-16-20(25)28-8-29-22(16)31/h3-4,6-9,15,18-19,24,32-35H,5H2,1-2H3,(H2,26,36)(H,27,37)(H2,25,28,29) |
| InChIKey | RHEFKQXMWOEMJH-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 231.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|