C19H21N7O9 — CID 10553118
N-[2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]ethyl]-2,3-dihydroxy-5-nitrobenzamide (PubChem CID 10553118) has the molecular formula C19H21N7O9 and a molecular weight of 491.42 g/mol. Its IUPAC name is N-[2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]ethyl]-2,3-dihydroxy-5-nitrobenzamide.
| Compound Name | N-[2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]ethyl]-2,3-dihydroxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 10553118 |
| Molecular Formula | C19H21N7O9 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | N-[2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]ethyl]-2,3-dihydroxy-5-nitrobenzamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COCCNC(=O)c2cc([N+](=O)[O-])cc(O)c2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H21N7O9/c20-16-12-17(23-6-22-16)25(7-24-12)19-15(30)14(29)11(35-19)5-34-2-1-21-18(31)9-3-8(26(32)33)4-10(27)13(9)28/h3-4,6-7,11,14-15,19,27-30H,1-2,5H2,(H,21,31)(H2,20,22,23)/t11-,14-,15-,19-/m1/s1 |
| InChIKey | XZTMLDCQALOCQY-FXRKXCAFSA-N |
| XLogP | -1.21 |
| TPSA | 241.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|