C22H26N6O6 — CID 91663448
N-[(E)-3-[(2R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enyl]-2,3-dihydroxy-5-propan-2-ylbenzamide (PubChem CID 91663448) has the molecular formula C22H26N6O6 and a molecular weight of 470.49 g/mol. Its IUPAC name is N-[(E)-3-[(2R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enyl]-2,3-dihydroxy-5-propan-2-ylbenzamide.
| Compound Name | N-[(E)-3-[(2R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enyl]-2,3-dihydroxy-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 91663448 |
| Molecular Formula | C22H26N6O6 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | N-[(E)-3-[(2R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enyl]-2,3-dihydroxy-5-propan-2-ylbenzamide |
| SMILES | CC(C)c1cc(O)c(O)c(C(=O)NC/C=C/[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)C2O)c1 |
| InChI | InChI=1S/C22H26N6O6/c1-10(2)11-6-12(16(30)13(29)7-11)21(33)24-5-3-4-14-17(31)18(32)22(34-14)28-9-27-15-19(23)25-8-26-20(15)28/h3-4,6-10,14,17-18,22,29-32H,5H2,1-2H3,(H,24,33)(H2,23,25,26)/b4-3+/t14-,17?,18-,22-/m1/s1 |
| InChIKey | JASYXLLZAVZQDT-AMGGRFMUSA-N |
| XLogP | 0.55 |
| TPSA | 188.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|