C37H11F15N4O6S2 — CID 136689901
5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-corrin-2,17-disulfonic acid (PubChem CID 136689901) has the molecular formula C37H11F15N4O6S2 and a molecular weight of 956.62 g/mol. Its IUPAC name is 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-corrin-2,17-disulfonic acid.
| Compound Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-corrin-2,17-disulfonic acid |
|---|---|
| PubChem CID | 136689901 |
| Molecular Formula | C37H11F15N4O6S2 |
| Molecular Weight | 956.62 g/mol |
| Exact Mass | 955.99 |
| IUPAC Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-corrin-2,17-disulfonic acid |
| SMILES | O=S(=O)(O)C1=Cc2nc1c(-c1c(F)c(F)c(F)c(F)c1F)c1ccc([nH]1)c(-c1c(F)c(F)c(F)c(F)c1F)c1ccc([nH]1)c(-c1c(F)c(F)c(F)c(F)c1F)c1cc(S(=O)(=O)O)c2[nH]1 |
| InChI | InChI=1S/C37H11F15N4O6S2/c38-21-18(22(39)28(45)33(50)27(21)44)15-7-1-2-9(53-7)16(19-23(40)29(46)34(51)30(47)24(19)41)11-5-13(63(57,58)59)36(55-11)12-6-14(64(60,61)62)37(56-12)17(10-4-3-8(15)54-10)20-25(42)31(48)35(52)32(49)26(20)43/h1-6,53-55H,(H,57,58,59)(H,60,61,62)/b15-7+,15-8+,16-9+,16-11+,17-10-,36-12-,37-17+ |
| InChIKey | MHVQGZRSYFMESB-DMNAXTKRSA-N |
| XLogP | 10.25 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.62 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|