C37H9F15N4O6S2-2 — CID 137144063
5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-23,24-dihydro-22H-corrin-2,17-disulfonate (PubChem CID 137144063) has the molecular formula C37H9F15N4O6S2-2 and a molecular weight of 954.60 g/mol. Its IUPAC name is 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-23,24-dihydro-22H-corrin-2,17-disulfonate.
| Compound Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-23,24-dihydro-22H-corrin-2,17-disulfonate |
|---|---|
| PubChem CID | 137144063 |
| Molecular Formula | C37H9F15N4O6S2-2 |
| Molecular Weight | 954.60 g/mol |
| Exact Mass | 953.97 |
| IUPAC Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-23,24-dihydro-22H-corrin-2,17-disulfonate |
| SMILES | O=S(=O)([O-])C1=Cc2nc1c1cc(S(=O)(=O)[O-])c([nH]1)c(-c1c(F)c(F)c(F)c(F)c1F)c1ccc([nH]1)c(-c1c(F)c(F)c(F)c(F)c1F)c1ccc([nH]1)c2-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C37H11F15N4O6S2/c38-21-18(22(39)28(45)33(50)27(21)44)15-7-1-2-9(53-7)16(19-23(40)29(46)34(51)30(47)24(19)41)11-5-13(63(57,58)59)36(55-11)12-6-14(64(60,61)62)37(56-12)17(10-4-3-8(15)54-10)20-25(42)31(48)35(52)32(49)26(20)43/h1-6,53-54,56H,(H,57,58,59)(H,60,61,62)/p-2/b15-7+,15-8+,16-9+,16-11+,17-10-,36-12-,37-17+ |
| InChIKey | AZFFAMGXLIHCNS-DMNAXTKRSA-L |
| XLogP | 9.56 |
| TPSA | 174.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.60 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|