C10H9+ — CID 136697279
3-methylidene-1,2-dihydroindene (PubChem CID 136697279) has the molecular formula C10H9+ and a molecular weight of 129.18 g/mol. Its IUPAC name is 3-methylidene-1,2-dihydroindene.
| Compound Name | 3-methylidene-1,2-dihydroindene |
|---|---|
| PubChem CID | 136697279 |
| Molecular Formula | C10H9+ |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.07 |
| IUPAC Name | 3-methylidene-1,2-dihydroindene |
| SMILES | [H]/[C+]=C1\CCc2ccccc21 |
| InChI | InChI=1S/C10H9/c1-8-6-7-9-4-2-3-5-10(8)9/h1-5H,6-7H2/q+1 |
| InChIKey | RMYPJYMOQXZLAW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|