C19H22ClN3 — CID 136711480
11H-benzo[b][1,4]benzodiazepin-6-yl(cyclohexyl)azanium chloride (PubChem CID 136711480) has the molecular formula C19H22ClN3 and a molecular weight of 327.86 g/mol. Its IUPAC name is 11H-benzo[b][1,4]benzodiazepin-6-yl(cyclohexyl)azanium chloride.
| Compound Name | 11H-benzo[b][1,4]benzodiazepin-6-yl(cyclohexyl)azanium chloride |
|---|---|
| PubChem CID | 136711480 |
| Molecular Formula | C19H22ClN3 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 11H-benzo[b][1,4]benzodiazepin-6-yl(cyclohexyl)azanium chloride |
| SMILES | [Cl-].c1ccc2c(c1)N=C([NH2+]C1CCCCC1)c1ccccc1N2 |
| InChI | InChI=1S/C19H21N3.ClH/c1-2-8-14(9-3-1)20-19-15-10-4-5-11-16(15)21-17-12-6-7-13-18(17)22-19;/h4-7,10-14,21H,1-3,8-9H2,(H,20,22);1H |
| InChIKey | DLOOWAYSCOPFIR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 41.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |