C18H20N2O2 — CID 136714950
7-(furan-2-ylmethyliminomethyl)-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-ol (PubChem CID 136714950) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 7-(furan-2-ylmethyliminomethyl)-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-ol.
| Compound Name | 7-(furan-2-ylmethyliminomethyl)-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-ol |
|---|---|
| PubChem CID | 136714950 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 7-(furan-2-ylmethyliminomethyl)-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-ol |
| SMILES | Oc1c(/C=N/Cc2ccco2)cc2c3c1CCCN3CCC2 |
| InChI | InChI=1S/C18H20N2O2/c21-18-14(11-19-12-15-5-3-9-22-15)10-13-4-1-7-20-8-2-6-16(18)17(13)20/h3,5,9-11,21H,1-2,4,6-8,12H2/b19-11+ |
| InChIKey | GVPFERHOVDJDGT-YBFXNURJSA-N |
| XLogP | 3.30 |
| TPSA | 48.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|