C14H12ClN5O4 — CID 136716156
2-[[(2S,4R)-2-chloro-4-(3-nitrophenyl)-3-oxoazetidin-1-yl]amino]-4-methyl-1H-pyrimidin-6-one (PubChem CID 136716156) has the molecular formula C14H12ClN5O4 and a molecular weight of 349.73 g/mol. Its IUPAC name is 2-[[(2S,4R)-2-chloro-4-(3-nitrophenyl)-3-oxoazetidin-1-yl]amino]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[[(2S,4R)-2-chloro-4-(3-nitrophenyl)-3-oxoazetidin-1-yl]amino]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136716156 |
| Molecular Formula | C14H12ClN5O4 |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-[[(2S,4R)-2-chloro-4-(3-nitrophenyl)-3-oxoazetidin-1-yl]amino]-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(NN2[C@@H](Cl)C(=O)[C@H]2c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C14H12ClN5O4/c1-7-5-10(21)17-14(16-7)18-19-11(12(22)13(19)15)8-3-2-4-9(6-8)20(23)24/h2-6,11,13H,1H3,(H2,16,17,18,21)/t11-,13-/m1/s1 |
| InChIKey | HEBFSZRHHAHSIC-DGCLKSJQSA-N |
| XLogP | 1.50 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|