C10H12N5+ — CID 136719732
3-pyridin-2-yl-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyrimidin-4-ium (PubChem CID 136719732) has the molecular formula C10H12N5+ and a molecular weight of 202.24 g/mol. Its IUPAC name is 3-pyridin-2-yl-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyrimidin-4-ium.
| Compound Name | 3-pyridin-2-yl-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyrimidin-4-ium |
|---|---|
| PubChem CID | 136719732 |
| Molecular Formula | C10H12N5+ |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-pyridin-2-yl-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyrimidin-4-ium |
| SMILES | c1ccc(-c2[nH]nc3[n+]2CCCN3)nc1 |
| InChI | InChI=1S/C10H11N5/c1-2-5-11-8(4-1)9-13-14-10-12-6-3-7-15(9)10/h1-2,4-5H,3,6-7H2,(H,11,12,14)/p+1 |
| InChIKey | PGHYRQZZACCURJ-UHFFFAOYSA-O |
| XLogP | 0.57 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|