C58H56N4Si — CID 136741827
trimethyl-[2-[4-[5,10,15-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-2-yl]phenyl]ethynyl]silane (PubChem CID 136741827) has the molecular formula C58H56N4Si and a molecular weight of 837.20 g/mol. Its IUPAC name is trimethyl-[2-[4-[5,10,15-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-2-yl]phenyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[4-[5,10,15-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-2-yl]phenyl]ethynyl]silane |
|---|---|
| PubChem CID | 136741827 |
| Molecular Formula | C58H56N4Si |
| Molecular Weight | 837.20 g/mol |
| Exact Mass | 836.43 |
| IUPAC Name | trimethyl-[2-[4-[5,10,15-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-2-yl]phenyl]ethynyl]silane |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4nc(cc5[nH]c2cc5-c2ccc(C#C[Si](C)(C)C)cc2)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C58H56N4Si/c1-33-25-36(4)53(37(5)26-33)56-46-18-17-44(59-46)31-51-45(43-15-13-42(14-16-43)23-24-63(10,11)12)32-52(62-51)58(55-40(8)29-35(3)30-41(55)9)50-22-21-49(61-50)57(48-20-19-47(56)60-48)54-38(6)27-34(2)28-39(54)7/h13-22,25-32,60,62H,1-12H3/b44-31-,51-31-,56-46+,56-47+,57-48+,57-49+,58-50+,58-52+ |
| InChIKey | DJIOIJXUHGLUGS-HXXHITLCSA-N |
| XLogP | 15.33 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.20 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|