C25H16ClN5O12S3 — CID 136802395
5-(4-chloro-6-phenoxy-1,3,5-triazin-2-yl)-4-hydroxy-3-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 136802395) has the molecular formula C25H16ClN5O12S3 and a molecular weight of 710.08 g/mol. Its IUPAC name is 5-(4-chloro-6-phenoxy-1,3,5-triazin-2-yl)-4-hydroxy-3-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 5-(4-chloro-6-phenoxy-1,3,5-triazin-2-yl)-4-hydroxy-3-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136802395 |
| Molecular Formula | C25H16ClN5O12S3 |
| Molecular Weight | 710.08 g/mol |
| Exact Mass | 708.96 |
| IUPAC Name | 5-(4-chloro-6-phenoxy-1,3,5-triazin-2-yl)-4-hydroxy-3-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(O)c(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(-c4nc(Cl)nc(Oc5ccccc5)n4)c3c2O)c1 |
| InChI | InChI=1S/C25H16ClN5O12S3/c26-24-27-23(28-25(29-24)43-13-4-2-1-3-5-13)16-10-15(45(37,38)39)8-12-9-19(46(40,41)42)21(22(33)20(12)16)31-30-17-11-14(44(34,35)36)6-7-18(17)32/h1-11,32-33H,(H,34,35,36)(H,37,38,39)(H,40,41,42)/b31-30+ |
| InChIKey | HGAJFMZHYHIJJY-NVQSTNCTSA-N |
| XLogP | 4.70 |
| TPSA | 276.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.08 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|