About CID 136808081
CID 136808081 (PubChem CID 136808081) has the molecular formula C16H48GeSi8
and a molecular weight of 537.86 g/mol.
Molecular Properties
| Compound Name | CID 136808081 |
| PubChem CID | 136808081 |
| Molecular Formula | C16H48GeSi8 |
| Molecular Weight | 537.86 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C.[Ge] |
| InChI | InChI=1S/C16H48Si8.Ge/c1-19(2,3)17(20(4,5)6)23(13,14)24(15,16)18(21(7,8)9)22(10,11)12;/h1-16H3; |
| InChIKey | DMHRYNBDZFDOBE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.86 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136808081 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136808081?
The IUPAC name of CID 136808081 (CID 136808081) is not available.
What is the SMILES notation for CID 136808081?
The canonical SMILES for CID 136808081 is C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C.[Ge].
What is the InChIKey of CID 136808081?
The InChIKey is DMHRYNBDZFDOBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H48Si8.Ge/c1-19(2,3)17(20(4,5)6)23(13,14)24(15,16)18(21(7,8)9)22(10,11)12;/h1-16H3;.
What are the key properties of CID 136808081?
CID 136808081 has a molecular weight of 537.86 g/mol, XLogP of 5.91, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136808081 is sourced from PubChem (CID 136808081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).