About CID 177454653
CID 177454653 (PubChem CID 177454653) has the molecular formula C19H57AlSi8
and a molecular weight of 537.34 g/mol.
Molecular Properties
| Compound Name | CID 177454653 |
| PubChem CID | 177454653 |
| Molecular Formula | C19H57AlSi8 |
| Molecular Weight | 537.34 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | — |
| SMILES | C[Al].C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C.C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/2C9H27Si4.CH3.Al/c2*1-11(2,3)10(12(4,5)6)13(7,8)9;;/h2*1-9H3;1H3; |
| InChIKey | MNLHSGSFEXUYDI-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.34 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177454653 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177454653?
The IUPAC name of CID 177454653 (CID 177454653) is not available.
What is the SMILES notation for CID 177454653?
The canonical SMILES for CID 177454653 is C[Al].C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C.C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of CID 177454653?
The InChIKey is MNLHSGSFEXUYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H27Si4.CH3.Al/c2*1-11(2,3)10(12(4,5)6)13(7,8)9;;/h2*1-9H3;1H3;.
What are the key properties of CID 177454653?
CID 177454653 has a molecular weight of 537.34 g/mol, XLogP of 7.66, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177454653 is sourced from PubChem (CID 177454653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).