C21H63Si10 — CID 136703264
CID 136703264 (PubChem CID 136703264) has the molecular formula C21H63Si10 and a molecular weight of 596.60 g/mol.
| Compound Name | CID 136703264 |
|---|---|
| PubChem CID | 136703264 |
| Molecular Formula | C21H63Si10 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)[Si]([Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C21H63Si10/c1-23(2,3)22(30(24(4,5)6,25(7,8)9)26(10,11)12)31(27(13,14)15,28(16,17)18)29(19,20)21/h1-21H3 |
| InChIKey | VVADQAVVNLAILI-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|