C27H40O2S — CID 136814234
4-hydroxy-3,5-dimethyl-5-[(1E,3E,7E,11E)-4,8,12,16-tetramethylheptadeca-1,3,7,11,15-pentaenyl]thiophen-2-one (PubChem CID 136814234) has the molecular formula C27H40O2S and a molecular weight of 428.68 g/mol. Its IUPAC name is 4-hydroxy-3,5-dimethyl-5-[(1E,3E,7E,11E)-4,8,12,16-tetramethylheptadeca-1,3,7,11,15-pentaenyl]thiophen-2-one.
| Compound Name | 4-hydroxy-3,5-dimethyl-5-[(1E,3E,7E,11E)-4,8,12,16-tetramethylheptadeca-1,3,7,11,15-pentaenyl]thiophen-2-one |
|---|---|
| PubChem CID | 136814234 |
| Molecular Formula | C27H40O2S |
| Molecular Weight | 428.68 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 4-hydroxy-3,5-dimethyl-5-[(1E,3E,7E,11E)-4,8,12,16-tetramethylheptadeca-1,3,7,11,15-pentaenyl]thiophen-2-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C=C/C1(C)SC(=O)C(C)=C1O |
| InChI | InChI=1S/C27H40O2S/c1-20(2)12-8-13-21(3)14-9-15-22(4)16-10-17-23(5)18-11-19-27(7)25(28)24(6)26(29)30-27/h11-12,14,16,18-19,28H,8-10,13,15,17H2,1-7H3/b19-11+,21-14+,22-16+,23-18+ |
| InChIKey | CLFSQJCUSUSWLS-SQVXYHDESA-N |
| XLogP | 8.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.68 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|