C15H24O2 — CID 144649740
2-(4,8-dimethylnona-1,3,7-trienyl)-2-methyl-1,3-dioxolane (PubChem CID 144649740) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-(4,8-dimethylnona-1,3,7-trienyl)-2-methyl-1,3-dioxolane.
| Compound Name | 2-(4,8-dimethylnona-1,3,7-trienyl)-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 144649740 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-(4,8-dimethylnona-1,3,7-trienyl)-2-methyl-1,3-dioxolane |
| SMILES | CC(C)=CCCC(C)=CC=CC1(C)OCCO1 |
| InChI | InChI=1S/C15H24O2/c1-13(2)7-5-8-14(3)9-6-10-15(4)16-11-12-17-15/h6-7,9-10H,5,8,11-12H2,1-4H3 |
| InChIKey | YZCZYIOLVQOOHU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|