C20H33N5O7 — CID 136828076
9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[[(4S,5R)-1,2,5-trihydroxydecan-4-yl]amino]-1H-purin-6-one (PubChem CID 136828076) has the molecular formula C20H33N5O7 and a molecular weight of 455.51 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[[(4S,5R)-1,2,5-trihydroxydecan-4-yl]amino]-1H-purin-6-one.
| Compound Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[[(4S,5R)-1,2,5-trihydroxydecan-4-yl]amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 136828076 |
| Molecular Formula | C20H33N5O7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[[(4S,5R)-1,2,5-trihydroxydecan-4-yl]amino]-1H-purin-6-one |
| SMILES | CCCCC[C@@H](O)[C@H](CC(O)CO)Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C20H33N5O7/c1-2-3-4-5-13(29)12(6-11(28)8-26)22-20-23-18-17(19(31)24-20)21-10-25(18)16-7-14(30)15(9-27)32-16/h10-16,26-30H,2-9H2,1H3,(H2,22,23,24,31)/t11?,12-,13+,14-,15+,16+/m0/s1 |
| InChIKey | PAQFQNIOLRDZIM-AHWBYSNRSA-N |
| XLogP | -0.77 |
| TPSA | 185.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|