C10H12F3N3O4 — CID 136842492
2-[4-amino-6-oxo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-5-yl]acetic acid (PubChem CID 136842492) has the molecular formula C10H12F3N3O4 and a molecular weight of 295.22 g/mol. Its IUPAC name is 2-[4-amino-6-oxo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[4-amino-6-oxo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136842492 |
| Molecular Formula | C10H12F3N3O4 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-[4-amino-6-oxo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-5-yl]acetic acid |
| SMILES | Nc1nc(CCOCC(F)(F)F)[nH]c(=O)c1CC(=O)O |
| InChI | InChI=1S/C10H12F3N3O4/c11-10(12,13)4-20-2-1-6-15-8(14)5(3-7(17)18)9(19)16-6/h1-4H2,(H,17,18)(H3,14,15,16,19) |
| InChIKey | CMYFLWCZMPTJQN-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|