C10H13F2N3O4 — CID 137012995
2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetic acid (PubChem CID 137012995) has the molecular formula C10H13F2N3O4 and a molecular weight of 277.23 g/mol. Its IUPAC name is 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 137012995 |
| Molecular Formula | C10H13F2N3O4 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-[4-amino-2-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyrimidin-5-yl]acetic acid |
| SMILES | Nc1nc(CCOCC(F)F)[nH]c(=O)c1CC(=O)O |
| InChI | InChI=1S/C10H13F2N3O4/c11-6(12)4-19-2-1-7-14-9(13)5(3-8(16)17)10(18)15-7/h6H,1-4H2,(H,16,17)(H3,13,14,15,18) |
| InChIKey | WCJUNNULEQQHPU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|