About CID 136870105
CID 136870105 (PubChem CID 136870105) has the molecular formula C16H19OPSi
and a molecular weight of 286.39 g/mol.
Molecular Properties
| Compound Name | CID 136870105 |
| PubChem CID | 136870105 |
| Molecular Formula | C16H19OPSi |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | — |
| SMILES | CCO[Si]CCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19OPSi/c1-2-17-19-14-13-18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,2,13-14H2,1H3 |
| InChIKey | ZAYFUGVPTZDJGK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 136870105 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136870105?
The IUPAC name of CID 136870105 (CID 136870105) is not available.
What is the SMILES notation for CID 136870105?
The canonical SMILES for CID 136870105 is CCO[Si]CCP(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 136870105?
The InChIKey is ZAYFUGVPTZDJGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19OPSi/c1-2-17-19-14-13-18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,2,13-14H2,1H3.
What are the key properties of CID 136870105?
CID 136870105 has a molecular weight of 286.39 g/mol, XLogP of 3.19, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136870105 is sourced from PubChem (CID 136870105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).