C32H42N4O9S2 — CID 136898111
5-(decanoylamino)-4-hydroxy-3-[[4-[(6Z)-6-hydroxyiminohexyl]phenyl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 136898111) has the molecular formula C32H42N4O9S2 and a molecular weight of 690.84 g/mol. Its IUPAC name is 5-(decanoylamino)-4-hydroxy-3-[[4-[(6Z)-6-hydroxyiminohexyl]phenyl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 5-(decanoylamino)-4-hydroxy-3-[[4-[(6Z)-6-hydroxyiminohexyl]phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136898111 |
| Molecular Formula | C32H42N4O9S2 |
| Molecular Weight | 690.84 g/mol |
| Exact Mass | 690.24 |
| IUPAC Name | 5-(decanoylamino)-4-hydroxy-3-[[4-[(6Z)-6-hydroxyiminohexyl]phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | CCCCCCCCCC(=O)Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc(CCCCC/C=N\O)cc3)c(O)c12 |
| InChI | InChI=1S/C32H42N4O9S2/c1-2-3-4-5-6-7-11-14-29(37)34-27-22-26(46(40,41)42)20-24-21-28(47(43,44)45)31(32(38)30(24)27)36-35-25-17-15-23(16-18-25)13-10-8-9-12-19-33-39/h15-22,38-39H,2-14H2,1H3,(H,34,37)(H,40,41,42)(H,43,44,45)/b33-19-,36-35+ |
| InChIKey | BHKUQMJVDPBQKT-MGKXEIFNSA-N |
| XLogP | 8.10 |
| TPSA | 215.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.84 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|