C19H27N6O7P — CID 136934066
propan-2-yl (2S)-2-[[(6aR,8S)-8-(2-amino-6-oxo-1H-purin-9-yl)-7-methylidene-4-oxo-6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2]trioxaphosphocin-4-yl]amino]propanoate (PubChem CID 136934066) has the molecular formula C19H27N6O7P and a molecular weight of 482.43 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(6aR,8S)-8-(2-amino-6-oxo-1H-purin-9-yl)-7-methylidene-4-oxo-6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2]trioxaphosphocin-4-yl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[(6aR,8S)-8-(2-amino-6-oxo-1H-purin-9-yl)-7-methylidene-4-oxo-6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2]trioxaphosphocin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 136934066 |
| Molecular Formula | C19H27N6O7P |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[(6aR,8S)-8-(2-amino-6-oxo-1H-purin-9-yl)-7-methylidene-4-oxo-6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2]trioxaphosphocin-4-yl]amino]propanoate |
| SMILES | C=C1[C@@H]2COP(=O)(N[C@@H](C)C(=O)OC(C)C)OCOC2C[C@@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C19H27N6O7P/c1-9(2)32-18(27)11(4)24-33(28)30-6-12-10(3)13(5-14(12)29-8-31-33)25-7-21-15-16(25)22-19(20)23-17(15)26/h7,9,11-14H,3,5-6,8H2,1-2,4H3,(H,24,28)(H3,20,22,23,26)/t11-,12-,13-,14?,33?/m0/s1 |
| InChIKey | ODJHKUINIDAORQ-ALQGVQTHSA-N |
| XLogP | 1.25 |
| TPSA | 172.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|