C7H11N3O3 — CID 136956915
4-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one (PubChem CID 136956915) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956915 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 4-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NCC(O)CO)nc[nH]1 |
| InChI | InChI=1S/C7H11N3O3/c11-3-5(12)2-8-6-1-7(13)10-4-9-6/h1,4-5,11-12H,2-3H2,(H2,8,9,10,13) |
| InChIKey | FRXCEVYQWLFGLT-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |