C25H24F4N9O4+ — CID 136966200
[(E)-4-[[4-[4-fluoro-3-(trifluoromethyl)anilino]pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[(2-methoxy-5-nitro-1H-imidazol-4-yl)methyl]-dimethylazanium (PubChem CID 136966200) has the molecular formula C25H24F4N9O4+ and a molecular weight of 590.52 g/mol. Its IUPAC name is [(E)-4-[[4-[4-fluoro-3-(trifluoromethyl)anilino]pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[(2-methoxy-5-nitro-1H-imidazol-4-yl)methyl]-dimethylazanium.
| Compound Name | [(E)-4-[[4-[4-fluoro-3-(trifluoromethyl)anilino]pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[(2-methoxy-5-nitro-1H-imidazol-4-yl)methyl]-dimethylazanium |
|---|---|
| PubChem CID | 136966200 |
| Molecular Formula | C25H24F4N9O4+ |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | [(E)-4-[[4-[4-fluoro-3-(trifluoromethyl)anilino]pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[(2-methoxy-5-nitro-1H-imidazol-4-yl)methyl]-dimethylazanium |
| SMILES | COc1nc(C[N+](C)(C)C/C=C/C(=O)Nc2cc3c(Nc4ccc(F)c(C(F)(F)F)c4)ncnc3cn2)c([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C25H23F4N9O4/c1-38(2,12-19-23(37(40)41)36-24(34-19)42-3)8-4-5-21(39)35-20-10-15-18(11-30-20)31-13-32-22(15)33-14-6-7-17(26)16(9-14)25(27,28)29/h4-7,9-11,13H,8,12H2,1-3H3,(H2-,30,31,32,33,34,35,36,39)/p+1/b5-4+ |
| InChIKey | HKGHDFHFFFHOIK-SNAWJCMRSA-O |
| XLogP | 4.34 |
| TPSA | 160.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|