C5H5BrN4 — CID 136981577
6-bromo-3,7-dihydro-2H-purine (PubChem CID 136981577) has the molecular formula C5H5BrN4 and a molecular weight of 201.03 g/mol. Its IUPAC name is 6-bromo-3,7-dihydro-2H-purine.
| Compound Name | 6-bromo-3,7-dihydro-2H-purine |
|---|---|
| PubChem CID | 136981577 |
| Molecular Formula | C5H5BrN4 |
| Molecular Weight | 201.03 g/mol |
| Exact Mass | 199.97 |
| IUPAC Name | 6-bromo-3,7-dihydro-2H-purine |
| SMILES | BrC1=NCNc2nc[nH]c21 |
| InChI | InChI=1S/C5H5BrN4/c6-4-3-5(9-1-7-3)10-2-8-4/h1,10H,2H2,(H,7,9) |
| InChIKey | XCNZHJPAGVNELZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.03 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |