C15H23N3O3 — CID 136988218
N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-[methyl(2-propoxyethyl)amino]acetamide (PubChem CID 136988218) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-[methyl(2-propoxyethyl)amino]acetamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-[methyl(2-propoxyethyl)amino]acetamide |
|---|---|
| PubChem CID | 136988218 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-[methyl(2-propoxyethyl)amino]acetamide |
| SMILES | CCCOCCN(C)CC(=O)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C15H23N3O3/c1-3-9-21-10-8-18(2)12-15(20)17-16-11-13-6-4-5-7-14(13)19/h4-7,11,19H,3,8-10,12H2,1-2H3,(H,17,20)/b16-11+ |
| InChIKey | JMDFATRONGDHBA-LFIBNONCSA-N |
| XLogP | 1.20 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|