C24H17N9S6 — CID 136997108
4-phenyl-5-[[4-phenyl-5-[(4-phenyl-5-sulfanyl-1,2,4-triazol-3-yl)disulfanyl]-1,2,4-triazol-3-yl]disulfanyl]-1,2,4-triazole-3-thiol (PubChem CID 136997108) has the molecular formula C24H17N9S6 and a molecular weight of 623.87 g/mol. Its IUPAC name is 4-phenyl-5-[[4-phenyl-5-[(4-phenyl-5-sulfanyl-1,2,4-triazol-3-yl)disulfanyl]-1,2,4-triazol-3-yl]disulfanyl]-1,2,4-triazole-3-thiol.
| Compound Name | 4-phenyl-5-[[4-phenyl-5-[(4-phenyl-5-sulfanyl-1,2,4-triazol-3-yl)disulfanyl]-1,2,4-triazol-3-yl]disulfanyl]-1,2,4-triazole-3-thiol |
|---|---|
| PubChem CID | 136997108 |
| Molecular Formula | C24H17N9S6 |
| Molecular Weight | 623.87 g/mol |
| Exact Mass | 622.99 |
| IUPAC Name | 4-phenyl-5-[[4-phenyl-5-[(4-phenyl-5-sulfanyl-1,2,4-triazol-3-yl)disulfanyl]-1,2,4-triazol-3-yl]disulfanyl]-1,2,4-triazole-3-thiol |
| SMILES | Sc1nnc(SSc2nnc(SSc3nnc(S)n3-c3ccccc3)n2-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C24H17N9S6/c34-19-25-27-21(31(19)16-10-4-1-5-11-16)36-38-23-29-30-24(33(23)18-14-8-3-9-15-18)39-37-22-28-26-20(35)32(22)17-12-6-2-7-13-17/h1-15H,(H,25,34)(H,26,35) |
| InChIKey | SSOOSFFIMBSFOQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.87 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|