C11H9NO3 — CID 137003005
2-[2-(2-hydroxyphenyl)-1,3-oxazol-5-yl]acetaldehyde (PubChem CID 137003005) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 2-[2-(2-hydroxyphenyl)-1,3-oxazol-5-yl]acetaldehyde.
| Compound Name | 2-[2-(2-hydroxyphenyl)-1,3-oxazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 137003005 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2-[2-(2-hydroxyphenyl)-1,3-oxazol-5-yl]acetaldehyde |
| SMILES | O=CCc1cnc(-c2ccccc2O)o1 |
| InChI | InChI=1S/C11H9NO3/c13-6-5-8-7-12-11(15-8)9-3-1-2-4-10(9)14/h1-4,6-7,14H,5H2 |
| InChIKey | CTZXCUWULNGGDD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|