C9H11N2OP — CID 137014834
(7R)-7-phosphanyl-3,6,7,8-tetrahydrocyclohepta[d]pyrimidin-4-one (PubChem CID 137014834) has the molecular formula C9H11N2OP and a molecular weight of 194.17 g/mol. Its IUPAC name is (7R)-7-phosphanyl-3,6,7,8-tetrahydrocyclohepta[d]pyrimidin-4-one.
| Compound Name | (7R)-7-phosphanyl-3,6,7,8-tetrahydrocyclohepta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137014834 |
| Molecular Formula | C9H11N2OP |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (7R)-7-phosphanyl-3,6,7,8-tetrahydrocyclohepta[d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1=CC[C@@H](P)CC=2 |
| InChI | InChI=1S/C9H11N2OP/c12-9-7-3-1-6(13)2-4-8(7)10-5-11-9/h3-6H,1-2,13H2,(H,10,11,12)/t6-/m1/s1 |
| InChIKey | OGRPELVRMLLONN-ZCFIWIBFSA-N |
| XLogP | -0.63 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|