C15H21ClN6S — CID 137033667
(3R,5S)-N-[(Z)-(8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-3,5-dimethylpiperazine-1-carbothioamide (PubChem CID 137033667) has the molecular formula C15H21ClN6S and a molecular weight of 352.90 g/mol. Its IUPAC name is (3R,5S)-N-[(Z)-(8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-3,5-dimethylpiperazine-1-carbothioamide.
| Compound Name | (3R,5S)-N-[(Z)-(8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-3,5-dimethylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 137033667 |
| Molecular Formula | C15H21ClN6S |
| Molecular Weight | 352.90 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (3R,5S)-N-[(Z)-(8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-3,5-dimethylpiperazine-1-carbothioamide |
| SMILES | C[C@@H]1CN(C(=S)N/N=C2/CCNc3c(Cl)ccnc32)C[C@H](C)N1 |
| InChI | InChI=1S/C15H21ClN6S/c1-9-7-22(8-10(2)19-9)15(23)21-20-12-4-6-17-13-11(16)3-5-18-14(12)13/h3,5,9-10,17,19H,4,6-8H2,1-2H3,(H,21,23)/b20-12-/t9-,10+ |
| InChIKey | WDASCGJNRKMDRN-UBSDPRFYSA-N |
| XLogP | 1.81 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.90 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|