C12H7ClN2O5S — CID 137060075
[(5Z)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]carbamic acid (PubChem CID 137060075) has the molecular formula C12H7ClN2O5S and a molecular weight of 326.72 g/mol. Its IUPAC name is [(5Z)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]carbamic acid.
| Compound Name | [(5Z)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]carbamic acid |
|---|---|
| PubChem CID | 137060075 |
| Molecular Formula | C12H7ClN2O5S |
| Molecular Weight | 326.72 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | [(5Z)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]carbamic acid |
| SMILES | O=C(O)N=C1NC(=O)/C(=C/c2cc3c(cc2Cl)OCO3)S1 |
| InChI | InChI=1S/C12H7ClN2O5S/c13-6-3-8-7(19-4-20-8)1-5(6)2-9-10(16)14-11(21-9)15-12(17)18/h1-3H,4H2,(H,17,18)(H,14,15,16)/b9-2- |
| InChIKey | TXHFSQWKFWLHDB-MBXJOHMKSA-N |
| XLogP | 2.31 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.72 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|