C14H11N3O4S — CID 137089442
2-[(2R)-5-(2-hydroxyphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]-4-nitrophenol (PubChem CID 137089442) has the molecular formula C14H11N3O4S and a molecular weight of 317.33 g/mol. Its IUPAC name is 2-[(2R)-5-(2-hydroxyphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]-4-nitrophenol.
| Compound Name | 2-[(2R)-5-(2-hydroxyphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]-4-nitrophenol |
|---|---|
| PubChem CID | 137089442 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-[(2R)-5-(2-hydroxyphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c([C@@H]2NN=C(c3ccccc3O)S2)c1 |
| InChI | InChI=1S/C14H11N3O4S/c18-11-4-2-1-3-9(11)13-15-16-14(22-13)10-7-8(17(20)21)5-6-12(10)19/h1-7,14,16,18-19H/t14-/m1/s1 |
| InChIKey | OOLHIUNCDYUMIZ-CQSZACIVSA-N |
| XLogP | 2.70 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|