C18H21N3OS — CID 135789024
2-[(2S)-2-[4-(diethylamino)phenyl]-2,3-dihydro-1,3,4-thiadiazol-5-yl]phenol (PubChem CID 135789024) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-[(2S)-2-[4-(diethylamino)phenyl]-2,3-dihydro-1,3,4-thiadiazol-5-yl]phenol.
| Compound Name | 2-[(2S)-2-[4-(diethylamino)phenyl]-2,3-dihydro-1,3,4-thiadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 135789024 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-[(2S)-2-[4-(diethylamino)phenyl]-2,3-dihydro-1,3,4-thiadiazol-5-yl]phenol |
| SMILES | CCN(CC)c1ccc([C@H]2NN=C(c3ccccc3O)S2)cc1 |
| InChI | InChI=1S/C18H21N3OS/c1-3-21(4-2)14-11-9-13(10-12-14)17-19-20-18(23-17)15-7-5-6-8-16(15)22/h5-12,17,19,22H,3-4H2,1-2H3/t17-/m0/s1 |
| InChIKey | ZIEYFFFXSJRKHR-KRWDZBQOSA-N |
| XLogP | 3.94 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|