C14H16N2O4 — CID 137092282
4-hydroxy-2,2-dimethyl-N'-(4-methylphenyl)-6-oxo-1,3-dioxine-5-carboximidamide (PubChem CID 137092282) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 4-hydroxy-2,2-dimethyl-N'-(4-methylphenyl)-6-oxo-1,3-dioxine-5-carboximidamide.
| Compound Name | 4-hydroxy-2,2-dimethyl-N'-(4-methylphenyl)-6-oxo-1,3-dioxine-5-carboximidamide |
|---|---|
| PubChem CID | 137092282 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-hydroxy-2,2-dimethyl-N'-(4-methylphenyl)-6-oxo-1,3-dioxine-5-carboximidamide |
| SMILES | Cc1ccc(/N=C(\N)C2=C(O)OC(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C14H16N2O4/c1-8-4-6-9(7-5-8)16-11(15)10-12(17)19-14(2,3)20-13(10)18/h4-7,17H,1-3H3,(H2,15,16) |
| InChIKey | NSIBKAQTXPNBAN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|