C18H11ClI2N2O3S — CID 137130878
4-chloro-N-[(5Z)-5-[(3,5-diiodo-2-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137130878) has the molecular formula C18H11ClI2N2O3S and a molecular weight of 624.63 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-5-[(3,5-diiodo-2-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | 4-chloro-N-[(5Z)-5-[(3,5-diiodo-2-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137130878 |
| Molecular Formula | C18H11ClI2N2O3S |
| Molecular Weight | 624.63 g/mol |
| Exact Mass | 623.83 |
| IUPAC Name | 4-chloro-N-[(5Z)-5-[(3,5-diiodo-2-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | COc1c(I)cc(I)cc1/C=C1\S/C(=N/C(=O)c2ccc(Cl)cc2)NC1=O |
| InChI | InChI=1S/C18H11ClI2N2O3S/c1-26-15-10(6-12(20)8-13(15)21)7-14-17(25)23-18(27-14)22-16(24)9-2-4-11(19)5-3-9/h2-8H,1H3,(H,22,23,24,25)/b14-7- |
| InChIKey | SBZLVOIJPXCWLL-AUWJEWJLSA-N |
| XLogP | 4.96 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|