C11H14N6O4 — CID 137139945
2-amino-9-[(2R,4E,5S)-5-(hydroxymethyl)-4-methoxyiminooxolan-2-yl]-1H-purin-6-one (PubChem CID 137139945) has the molecular formula C11H14N6O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-amino-9-[(2R,4E,5S)-5-(hydroxymethyl)-4-methoxyiminooxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4E,5S)-5-(hydroxymethyl)-4-methoxyiminooxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137139945 |
| Molecular Formula | C11H14N6O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-amino-9-[(2R,4E,5S)-5-(hydroxymethyl)-4-methoxyiminooxolan-2-yl]-1H-purin-6-one |
| SMILES | CO/N=C1\C[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@@H]1CO |
| InChI | InChI=1S/C11H14N6O4/c1-20-16-5-2-7(21-6(5)3-18)17-4-13-8-9(17)14-11(12)15-10(8)19/h4,6-7,18H,2-3H2,1H3,(H3,12,14,15,19)/b16-5+/t6-,7-/m1/s1 |
| InChIKey | HPEDPHOIGPULJQ-AXWUHBIHSA-N |
| XLogP | -1.02 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|