C28H30FN7O2 — CID 137146911
N-[3-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7-methyl-4-oxo-3,5-dihydropyrido[2,3-d]pyrimidin-8-yl]phenyl]prop-2-enamide (PubChem CID 137146911) has the molecular formula C28H30FN7O2 and a molecular weight of 515.59 g/mol. Its IUPAC name is N-[3-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7-methyl-4-oxo-3,5-dihydropyrido[2,3-d]pyrimidin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7-methyl-4-oxo-3,5-dihydropyrido[2,3-d]pyrimidin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 137146911 |
| Molecular Formula | C28H30FN7O2 |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | N-[3-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7-methyl-4-oxo-3,5-dihydropyrido[2,3-d]pyrimidin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(N2C(C)=CCc3c2nc(Nc2ccc(N4CCN(C)CC4)c(F)c2)[nH]c3=O)c1 |
| InChI | InChI=1S/C28H30FN7O2/c1-4-25(37)30-19-6-5-7-21(16-19)36-18(2)8-10-22-26(36)32-28(33-27(22)38)31-20-9-11-24(23(29)17-20)35-14-12-34(3)13-15-35/h4-9,11,16-17H,1,10,12-15H2,2-3H3,(H,30,37)(H2,31,32,33,38) |
| InChIKey | RHYUFVIVNYZXCQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|