C9H10N4 — CID 137156336
10-methyl-2,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene (PubChem CID 137156336) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 10-methyl-2,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene.
| Compound Name | 10-methyl-2,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene |
|---|---|
| PubChem CID | 137156336 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 10-methyl-2,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene |
| SMILES | Cc1cc2[nH]nc3c2c(n1)CCN3 |
| InChI | InChI=1S/C9H10N4/c1-5-4-7-8-6(11-5)2-3-10-9(8)13-12-7/h4H,2-3H2,1H3,(H2,10,12,13) |
| InChIKey | VABYIMBGLJMSRA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |