C22H21ClN4O3S — CID 137157455
[4-[4-(2-buta-1,3-dienyl-3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-2-chloro-5-hydroxyphenyl] N,N-dimethylcarbamate (PubChem CID 137157455) has the molecular formula C22H21ClN4O3S and a molecular weight of 456.96 g/mol. Its IUPAC name is [4-[4-(2-buta-1,3-dienyl-3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-2-chloro-5-hydroxyphenyl] N,N-dimethylcarbamate.
| Compound Name | [4-[4-(2-buta-1,3-dienyl-3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-2-chloro-5-hydroxyphenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 137157455 |
| Molecular Formula | C22H21ClN4O3S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | [4-[4-(2-buta-1,3-dienyl-3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-2-chloro-5-hydroxyphenyl] N,N-dimethylcarbamate |
| SMILES | C=CC=Cc1c(C)cccc1-n1c(-c2cc(Cl)c(OC(=O)N(C)C)cc2O)n[nH]c1=S |
| InChI | InChI=1S/C22H21ClN4O3S/c1-5-6-9-14-13(2)8-7-10-17(14)27-20(24-25-21(27)31)15-11-16(23)19(12-18(15)28)30-22(29)26(3)4/h5-12,28H,1H2,2-4H3,(H,25,31) |
| InChIKey | QZNJPYGZSVGAJN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|