C16H21N5O7S — CID 137193130
ethyl 2-[[2-acetamido-9-(2-acetyloxyethoxymethyl)-6-oxo-1H-purin-8-yl]sulfanyl]acetate (PubChem CID 137193130) has the molecular formula C16H21N5O7S and a molecular weight of 427.44 g/mol. Its IUPAC name is ethyl 2-[[2-acetamido-9-(2-acetyloxyethoxymethyl)-6-oxo-1H-purin-8-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[2-acetamido-9-(2-acetyloxyethoxymethyl)-6-oxo-1H-purin-8-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 137193130 |
| Molecular Formula | C16H21N5O7S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | ethyl 2-[[2-acetamido-9-(2-acetyloxyethoxymethyl)-6-oxo-1H-purin-8-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nc2c(=O)[nH]c(NC(C)=O)nc2n1COCCOC(C)=O |
| InChI | InChI=1S/C16H21N5O7S/c1-4-27-11(24)7-29-16-18-12-13(19-15(17-9(2)22)20-14(12)25)21(16)8-26-5-6-28-10(3)23/h4-8H2,1-3H3,(H2,17,19,20,22,25) |
| InChIKey | QCQBMDIZFKOFBP-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|