C18H14N4OS — CID 137206725
(3E)-3-[(Z)-(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one (PubChem CID 137206725) has the molecular formula C18H14N4OS and a molecular weight of 334.40 g/mol. Its IUPAC name is (3E)-3-[(Z)-(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one.
| Compound Name | (3E)-3-[(Z)-(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 137206725 |
| Molecular Formula | C18H14N4OS |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (3E)-3-[(Z)-(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one |
| SMILES | Cn1c(-c2ccccc2)cs/c1=N\N=C1\C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C18H14N4OS/c1-22-15(12-7-3-2-4-8-12)11-24-18(22)21-20-16-13-9-5-6-10-14(13)19-17(16)23/h2-11H,1H3,(H,19,20,23)/b21-18- |
| InChIKey | PGVJDLQFMWTPDD-UZYVYHOESA-N |
| XLogP | 3.01 |
| TPSA | 58.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|