C19H13N5OS — CID 137206670
4-[(2Z)-3-methyl-2-[(E)-(2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazol-4-yl]benzonitrile (PubChem CID 137206670) has the molecular formula C19H13N5OS and a molecular weight of 359.41 g/mol. Its IUPAC name is 4-[(2Z)-3-methyl-2-[(E)-(2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[(2Z)-3-methyl-2-[(E)-(2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 137206670 |
| Molecular Formula | C19H13N5OS |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 4-[(2Z)-3-methyl-2-[(E)-(2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazol-4-yl]benzonitrile |
| SMILES | Cn1c(-c2ccc(C#N)cc2)cs/c1=N\N=C1\C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C19H13N5OS/c1-24-16(13-8-6-12(10-20)7-9-13)11-26-19(24)23-22-17-14-4-2-3-5-15(14)21-18(17)25/h2-9,11H,1H3,(H,21,22,25)/b23-19- |
| InChIKey | XTLWQYJYCFGIQM-NMWGTECJSA-N |
| XLogP | 2.88 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|