C25H31ClN2O6 — CID 137216409
3-O-benzyl 1-O-tert-butyl (2R)-2-[2-[5-(C-chloro-N-hydroxycarbonimidoyl)-4-cyclopropyl-1,2-oxazol-3-yl]butyl]propanedioate (PubChem CID 137216409) has the molecular formula C25H31ClN2O6 and a molecular weight of 490.98 g/mol. Its IUPAC name is 3-O-benzyl 1-O-tert-butyl (2R)-2-[2-[5-(C-chloro-N-hydroxycarbonimidoyl)-4-cyclopropyl-1,2-oxazol-3-yl]butyl]propanedioate.
| Compound Name | 3-O-benzyl 1-O-tert-butyl (2R)-2-[2-[5-(C-chloro-N-hydroxycarbonimidoyl)-4-cyclopropyl-1,2-oxazol-3-yl]butyl]propanedioate |
|---|---|
| PubChem CID | 137216409 |
| Molecular Formula | C25H31ClN2O6 |
| Molecular Weight | 490.98 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 3-O-benzyl 1-O-tert-butyl (2R)-2-[2-[5-(C-chloro-N-hydroxycarbonimidoyl)-4-cyclopropyl-1,2-oxazol-3-yl]butyl]propanedioate |
| SMILES | CCC(C[C@H](C(=O)OCc1ccccc1)C(=O)OC(C)(C)C)c1noc(C(Cl)=NO)c1C1CC1 |
| InChI | InChI=1S/C25H31ClN2O6/c1-5-16(20-19(17-11-12-17)21(34-28-20)22(26)27-31)13-18(24(30)33-25(2,3)4)23(29)32-14-15-9-7-6-8-10-15/h6-10,16-18,31H,5,11-14H2,1-4H3/t16?,18-/m1/s1 |
| InChIKey | OYRRMDFFXZRQFZ-UHUGOGIASA-N |
| XLogP | 5.51 |
| TPSA | 111.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.98 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|