C54H36N8 — CID 137222990
2-[2-(21,23-dihydroporphyrin-2-yl)-1,2-diphenylethenyl]-21,23-dihydroporphyrin (PubChem CID 137222990) has the molecular formula C54H36N8 and a molecular weight of 796.94 g/mol. Its IUPAC name is 2-[2-(21,23-dihydroporphyrin-2-yl)-1,2-diphenylethenyl]-21,23-dihydroporphyrin.
| Compound Name | 2-[2-(21,23-dihydroporphyrin-2-yl)-1,2-diphenylethenyl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 137222990 |
| Molecular Formula | C54H36N8 |
| Molecular Weight | 796.94 g/mol |
| Exact Mass | 796.31 |
| IUPAC Name | 2-[2-(21,23-dihydroporphyrin-2-yl)-1,2-diphenylethenyl]-21,23-dihydroporphyrin |
| SMILES | C1=Cc2cc3cc(C(=C(c4ccccc4)c4cc5cc6nc(cc7ccc(cc8nc(cc4[nH]5)C=C8)[nH]7)C=C6)c4ccccc4)c(cc4nc(cc5ccc(cc1n2)[nH]5)C=C4)[nH]3 |
| InChI | InChI=1S/C54H36N8/c1-3-7-33(8-4-1)53(49-29-47-27-43-17-15-39(57-43)23-35-11-13-37(55-35)25-41-19-21-45(59-41)31-51(49)61-47)54(34-9-5-2-6-10-34)50-30-48-28-44-18-16-40(58-44)24-36-12-14-38(56-36)26-42-20-22-46(60-42)32-52(50)62-48/h1-32,55-56,61-62H/b35-23-,36-24-,37-25-,38-26-,39-23-,40-24-,41-25-,42-26-,43-27-,44-28-,45-31-,46-32-,47-27-,48-28-,51-31-,52-32-,54-53? |
| InChIKey | IZBQMZNJYUDKEU-TXZUABTDSA-N |
| XLogP | 12.63 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.94 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|